About 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide
4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide (PubChem CID 82003871) has the molecular formula C6H12F2N2O2
and a molecular weight of 182.17 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide |
| PubChem CID | 82003871 |
| Molecular Formula | C6H12F2N2O2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide |
| SMILES | NC(CCCOCC(F)F)=NO |
| InChI | InChI=1S/C6H12F2N2O2/c7-5(8)4-12-3-1-2-6(9)10-11/h5,11H,1-4H2,(H2,9,10) |
| InChIKey | DKKJNWMBLHLWQW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide?
The IUPAC name of 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide (CID 82003871) is 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide.
What is the SMILES notation for 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide?
The canonical SMILES for 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide is NC(CCCOCC(F)F)=NO.
What is the InChIKey of 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide?
The InChIKey is DKKJNWMBLHLWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F2N2O2/c7-5(8)4-12-3-1-2-6(9)10-11/h5,11H,1-4H2,(H2,9,10).
What are the key properties of 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide?
4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide has a molecular weight of 182.17 g/mol, XLogP of 0.79, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethoxy)-N'-hydroxybutanimidamide is sourced from PubChem (CID 82003871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).