About 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine
2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine (PubChem CID 82004238) has the molecular formula C10H19F2NO
and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine |
| PubChem CID | 82004238 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine |
| SMILES | CNC1CCCCCC1OCC(F)F |
| InChI | InChI=1S/C10H19F2NO/c1-13-8-5-3-2-4-6-9(8)14-7-10(11)12/h8-10,13H,2-7H2,1H3 |
| InChIKey | DTOWMJIAMPBWPP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine?
The IUPAC name of 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine (CID 82004238) is 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine.
What is the SMILES notation for 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine?
The canonical SMILES for 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine is CNC1CCCCCC1OCC(F)F.
What is the InChIKey of 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine?
The InChIKey is DTOWMJIAMPBWPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO/c1-13-8-5-3-2-4-6-9(8)14-7-10(11)12/h8-10,13H,2-7H2,1H3.
What are the key properties of 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine?
2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine has a molecular weight of 207.26 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)-N-methylcycloheptan-1-amine is sourced from PubChem (CID 82004238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).