About 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine
2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine (PubChem CID 82004254) has the molecular formula C6H4Cl2F2N2O
and a molecular weight of 229.01 g/mol. Its IUPAC name is 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine.
Molecular Properties
| Compound Name | 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine |
| PubChem CID | 82004254 |
| Molecular Formula | C6H4Cl2F2N2O |
| Molecular Weight | 229.01 g/mol |
| Exact Mass | 227.97 |
| IUPAC Name | 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine |
| SMILES | FC(F)COc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C6H4Cl2F2N2O/c7-3-1-11-6(8)12-5(3)13-2-4(9)10/h1,4H,2H2 |
| InChIKey | IRNLHKCHZSLPER-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.01 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine?
The IUPAC name of 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine (CID 82004254) is 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine.
What is the SMILES notation for 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine?
The canonical SMILES for 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine is FC(F)COc1nc(Cl)ncc1Cl.
What is the InChIKey of 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine?
The InChIKey is IRNLHKCHZSLPER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2F2N2O/c7-3-1-11-6(8)12-5(3)13-2-4(9)10/h1,4H,2H2.
What are the key properties of 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine?
2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine has a molecular weight of 229.01 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-4-(2,2-difluoroethoxy)pyrimidine is sourced from PubChem (CID 82004254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).