C10H8Cl2N4O — CID 820043
6-(2,4-dichlorophenoxy)pyrimidine-2,4-diamine (PubChem CID 820043) has the molecular formula C10H8Cl2N4O and a molecular weight of 271.11 g/mol. Its IUPAC name is 6-(2,4-dichlorophenoxy)pyrimidine-2,4-diamine.
| Compound Name | 6-(2,4-dichlorophenoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 820043 |
| Molecular Formula | C10H8Cl2N4O |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 6-(2,4-dichlorophenoxy)pyrimidine-2,4-diamine |
| SMILES | Nc1cc(Oc2ccc(Cl)cc2Cl)nc(N)n1 |
| InChI | InChI=1S/C10H8Cl2N4O/c11-5-1-2-7(6(12)3-5)17-9-4-8(13)15-10(14)16-9/h1-4H,(H4,13,14,15,16) |
| InChIKey | JCKMRGRBJIGNON-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |