About 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine
4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine (PubChem CID 82004361) has the molecular formula C7H7ClF2N2OS
and a molecular weight of 240.66 g/mol. Its IUPAC name is 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine |
| PubChem CID | 82004361 |
| Molecular Formula | C7H7ClF2N2OS |
| Molecular Weight | 240.66 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine |
| SMILES | CSc1nc(Cl)cc(OCC(F)F)n1 |
| InChI | InChI=1S/C7H7ClF2N2OS/c1-14-7-11-4(8)2-6(12-7)13-3-5(9)10/h2,5H,3H2,1H3 |
| InChIKey | WOGHWFQYZKJDPK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.66 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine?
The IUPAC name of 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine (CID 82004361) is 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine.
What is the SMILES notation for 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine?
The canonical SMILES for 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine is CSc1nc(Cl)cc(OCC(F)F)n1.
What is the InChIKey of 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine?
The InChIKey is WOGHWFQYZKJDPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClF2N2OS/c1-14-7-11-4(8)2-6(12-7)13-3-5(9)10/h2,5H,3H2,1H3.
What are the key properties of 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine?
4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine has a molecular weight of 240.66 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(2,2-difluoroethoxy)-2-methylsulfanylpyrimidine is sourced from PubChem (CID 82004361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).