About 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide
5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 82004381) has the molecular formula C8H12F2N4O
and a molecular weight of 218.21 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide |
| PubChem CID | 82004381 |
| Molecular Formula | C8H12F2N4O |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1OCC(F)F |
| InChI | InChI=1S/C8H12F2N4O/c1-4-6(7(11)12)8(14(2)13-4)15-3-5(9)10/h5H,3H2,1-2H3,(H3,11,12) |
| InChIKey | BJMBHTNDNSCWSO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide?
The IUPAC name of 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide (CID 82004381) is 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide.
What is the SMILES notation for 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide?
The canonical SMILES for 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide is [H]/N=C(\N)c1c(C)nn(C)c1OCC(F)F.
What is the InChIKey of 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide?
The InChIKey is BJMBHTNDNSCWSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N4O/c1-4-6(7(11)12)8(14(2)13-4)15-3-5(9)10/h5H,3H2,1-2H3,(H3,11,12).
What are the key properties of 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide?
5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide has a molecular weight of 218.21 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethoxy)-1,3-dimethylpyrazole-4-carboximidamide is sourced from PubChem (CID 82004381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).