6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid

C8H6ClF2NO3 — CID 82004536

IUPAC6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(Cl)nc1OCC(F)F
InChIInChI=1S/C8H6ClF2NO3/c9-5-2-1-4(8(13)14)7(12-5)15-3-6(10)11/h1-2,6H,3H2,(H,13,14)
InChIKeyNIGCYINUYCEWKP-UHFFFAOYSA-N
MW237.59 g/mol
LogP2.08
Rot. Bonds4

About 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid

6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid (PubChem CID 82004536) has the molecular formula C8H6ClF2NO3 and a molecular weight of 237.59 g/mol. Its IUPAC name is 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid
PubChem CID82004536
Molecular FormulaC8H6ClF2NO3
Molecular Weight237.59 g/mol
Exact Mass237.00
IUPAC Name6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid
SMILESO=C(O)c1ccc(Cl)nc1OCC(F)F
InChIInChI=1S/C8H6ClF2NO3/c9-5-2-1-4(8(13)14)7(12-5)15-3-6(10)11/h1-2,6H,3H2,(H,13,14)
InChIKeyNIGCYINUYCEWKP-UHFFFAOYSA-N
XLogP2.08
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.59
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid?
The IUPAC name of 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid (CID 82004536) is 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid.
What is the SMILES notation for 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid?
The canonical SMILES for 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid is O=C(O)c1ccc(Cl)nc1OCC(F)F.
What is the InChIKey of 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid?
The InChIKey is NIGCYINUYCEWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF2NO3/c9-5-2-1-4(8(13)14)7(12-5)15-3-6(10)11/h1-2,6H,3H2,(H,13,14).
What are the key properties of 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid?
6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid has a molecular weight of 237.59 g/mol, XLogP of 2.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(2,2-difluoroethoxy)pyridine-3-carboxylic acid is sourced from PubChem (CID 82004536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).