About [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine
[5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine (PubChem CID 82004607) has the molecular formula C7H9F2N3O
and a molecular weight of 189.17 g/mol. Its IUPAC name is [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine |
| PubChem CID | 82004607 |
| Molecular Formula | C7H9F2N3O |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine |
| SMILES | NCc1cnc(OCC(F)F)cn1 |
| InChI | InChI=1S/C7H9F2N3O/c8-6(9)4-13-7-3-11-5(1-10)2-12-7/h2-3,6H,1,4,10H2 |
| InChIKey | FBJUOANJCQIKJU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine?
The IUPAC name of [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine (CID 82004607) is [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine.
What is the SMILES notation for [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine?
The canonical SMILES for [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine is NCc1cnc(OCC(F)F)cn1.
What is the InChIKey of [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine?
The InChIKey is FBJUOANJCQIKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2N3O/c8-6(9)4-13-7-3-11-5(1-10)2-12-7/h2-3,6H,1,4,10H2.
What are the key properties of [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine?
[5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine has a molecular weight of 189.17 g/mol, XLogP of 0.58, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,2-difluoroethoxy)pyrazin-2-yl]methanamine is sourced from PubChem (CID 82004607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).