About 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine
4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine (PubChem CID 82004616) has the molecular formula C10H21F2NO
and a molecular weight of 209.28 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine |
| PubChem CID | 82004616 |
| Molecular Formula | C10H21F2NO |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine |
| SMILES | CCC(N)C(OCC(F)F)C(C)(C)C |
| InChI | InChI=1S/C10H21F2NO/c1-5-7(13)9(10(2,3)4)14-6-8(11)12/h7-9H,5-6,13H2,1-4H3 |
| InChIKey | RWYDJCPAJGSZBA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine?
The IUPAC name of 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine (CID 82004616) is 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine.
What is the SMILES notation for 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine?
The canonical SMILES for 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine is CCC(N)C(OCC(F)F)C(C)(C)C.
What is the InChIKey of 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine?
The InChIKey is RWYDJCPAJGSZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F2NO/c1-5-7(13)9(10(2,3)4)14-6-8(11)12/h7-9H,5-6,13H2,1-4H3.
What are the key properties of 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine?
4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine has a molecular weight of 209.28 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethoxy)-5,5-dimethylhexan-3-amine is sourced from PubChem (CID 82004616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).