About 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine
7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 82004752) has the molecular formula C10H17F2NO3
and a molecular weight of 237.25 g/mol. Its IUPAC name is 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
Molecular Properties
| Compound Name | 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| PubChem CID | 82004752 |
| Molecular Formula | C10H17F2NO3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | NC1CCC2(CC1OCC(F)F)OCCO2 |
| InChI | InChI=1S/C10H17F2NO3/c11-9(12)6-14-8-5-10(2-1-7(8)13)15-3-4-16-10/h7-9H,1-6,13H2 |
| InChIKey | SHTLERWXMFMOBP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine?
The IUPAC name of 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine (CID 82004752) is 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine.
What is the SMILES notation for 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine?
The canonical SMILES for 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine is NC1CCC2(CC1OCC(F)F)OCCO2.
What is the InChIKey of 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine?
The InChIKey is SHTLERWXMFMOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO3/c11-9(12)6-14-8-5-10(2-1-7(8)13)15-3-4-16-10/h7-9H,1-6,13H2.
What are the key properties of 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine?
7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine has a molecular weight of 237.25 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,2-difluoroethoxy)-1,4-dioxaspiro[4.5]decan-8-amine is sourced from PubChem (CID 82004752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).