About [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine
[3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine (PubChem CID 82004811) has the molecular formula C9H13F2N3O
and a molecular weight of 217.22 g/mol. Its IUPAC name is [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine.
Molecular Properties
| Compound Name | [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine |
| PubChem CID | 82004811 |
| Molecular Formula | C9H13F2N3O |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine |
| SMILES | Cc1nnc(OCC(F)F)c(CN)c1C |
| InChI | InChI=1S/C9H13F2N3O/c1-5-6(2)13-14-9(7(5)3-12)15-4-8(10)11/h8H,3-4,12H2,1-2H3 |
| InChIKey | ORCIBIFXVCAYPG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine?
The IUPAC name of [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine (CID 82004811) is [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine.
What is the SMILES notation for [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine?
The canonical SMILES for [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine is Cc1nnc(OCC(F)F)c(CN)c1C.
What is the InChIKey of [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine?
The InChIKey is ORCIBIFXVCAYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O/c1-5-6(2)13-14-9(7(5)3-12)15-4-8(10)11/h8H,3-4,12H2,1-2H3.
What are the key properties of [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine?
[3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine has a molecular weight of 217.22 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-difluoroethoxy)-5,6-dimethylpyridazin-4-yl]methanamine is sourced from PubChem (CID 82004811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).