About [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine
[4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine (PubChem CID 82004941) has the molecular formula C11H15F2NO3S
and a molecular weight of 279.31 g/mol. Its IUPAC name is [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine |
| PubChem CID | 82004941 |
| Molecular Formula | C11H15F2NO3S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine |
| SMILES | NCc1ccc(S(=O)(=O)CCOCC(F)F)cc1 |
| InChI | InChI=1S/C11H15F2NO3S/c12-11(13)8-17-5-6-18(15,16)10-3-1-9(7-14)2-4-10/h1-4,11H,5-8,14H2 |
| InChIKey | AFQWBTOQIDLXBI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine?
The IUPAC name of [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine (CID 82004941) is [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine.
What is the SMILES notation for [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine?
The canonical SMILES for [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine is NCc1ccc(S(=O)(=O)CCOCC(F)F)cc1.
What is the InChIKey of [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine?
The InChIKey is AFQWBTOQIDLXBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO3S/c12-11(13)8-17-5-6-18(15,16)10-3-1-9(7-14)2-4-10/h1-4,11H,5-8,14H2.
What are the key properties of [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine?
[4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine has a molecular weight of 279.31 g/mol, XLogP of 1.20, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2,2-difluoroethoxy)ethylsulfonyl]phenyl]methanamine is sourced from PubChem (CID 82004941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).