About 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine
3-(2,2-difluoroethoxy)-N-propyloxan-4-amine (PubChem CID 82005049) has the molecular formula C10H19F2NO2
and a molecular weight of 223.26 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine |
| PubChem CID | 82005049 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine |
| SMILES | CCCNC1CCOCC1OCC(F)F |
| InChI | InChI=1S/C10H19F2NO2/c1-2-4-13-8-3-5-14-6-9(8)15-7-10(11)12/h8-10,13H,2-7H2,1H3 |
| InChIKey | HBMUQQOKMFUGPK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine?
The IUPAC name of 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine (CID 82005049) is 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine.
What is the SMILES notation for 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine?
The canonical SMILES for 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine is CCCNC1CCOCC1OCC(F)F.
What is the InChIKey of 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine?
The InChIKey is HBMUQQOKMFUGPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO2/c1-2-4-13-8-3-5-14-6-9(8)15-7-10(11)12/h8-10,13H,2-7H2,1H3.
What are the key properties of 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine?
3-(2,2-difluoroethoxy)-N-propyloxan-4-amine has a molecular weight of 223.26 g/mol, XLogP of 1.43, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethoxy)-N-propyloxan-4-amine is sourced from PubChem (CID 82005049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).