About 6-(2,2-difluoroethoxy)hexan-2-amine
6-(2,2-difluoroethoxy)hexan-2-amine (PubChem CID 82005261) has the molecular formula C8H17F2NO
and a molecular weight of 181.23 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)hexan-2-amine.
Molecular Properties
| Compound Name | 6-(2,2-difluoroethoxy)hexan-2-amine |
| PubChem CID | 82005261 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 6-(2,2-difluoroethoxy)hexan-2-amine |
| SMILES | CC(N)CCCCOCC(F)F |
| InChI | InChI=1S/C8H17F2NO/c1-7(11)4-2-3-5-12-6-8(9)10/h7-8H,2-6,11H2,1H3 |
| InChIKey | JTBFUNYGPDSZTC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,2-difluoroethoxy)hexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-difluoroethoxy)hexan-2-amine?
The IUPAC name of 6-(2,2-difluoroethoxy)hexan-2-amine (CID 82005261) is 6-(2,2-difluoroethoxy)hexan-2-amine.
What is the SMILES notation for 6-(2,2-difluoroethoxy)hexan-2-amine?
The canonical SMILES for 6-(2,2-difluoroethoxy)hexan-2-amine is CC(N)CCCCOCC(F)F.
What is the InChIKey of 6-(2,2-difluoroethoxy)hexan-2-amine?
The InChIKey is JTBFUNYGPDSZTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F2NO/c1-7(11)4-2-3-5-12-6-8(9)10/h7-8H,2-6,11H2,1H3.
What are the key properties of 6-(2,2-difluoroethoxy)hexan-2-amine?
6-(2,2-difluoroethoxy)hexan-2-amine has a molecular weight of 181.23 g/mol, XLogP of 1.79, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoroethoxy)hexan-2-amine is sourced from PubChem (CID 82005261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).