About 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole
5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole (PubChem CID 82005304) has the molecular formula C13H6Cl2F2N2
and a molecular weight of 299.11 g/mol. Its IUPAC name is 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole |
| PubChem CID | 82005304 |
| Molecular Formula | C13H6Cl2F2N2 |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole |
| SMILES | Fc1cc(F)cc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)c1 |
| InChI | InChI=1S/C13H6Cl2F2N2/c14-9-4-11-12(5-10(9)15)19-13(18-11)6-1-7(16)3-8(17)2-6/h1-5H,(H,18,19) |
| InChIKey | KCCKRFLIBFIEHJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole?
The IUPAC name of 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole (CID 82005304) is 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole.
What is the SMILES notation for 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole?
The canonical SMILES for 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole is Fc1cc(F)cc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)c1.
What is the InChIKey of 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole?
The InChIKey is KCCKRFLIBFIEHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Cl2F2N2/c14-9-4-11-12(5-10(9)15)19-13(18-11)6-1-7(16)3-8(17)2-6/h1-5H,(H,18,19).
What are the key properties of 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole?
5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole has a molecular weight of 299.11 g/mol, XLogP of 4.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-2-(3,5-difluorophenyl)-1H-benzimidazole is sourced from PubChem (CID 82005304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).