About N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide
N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide (PubChem CID 82005349) has the molecular formula C9H18F2N2O2
and a molecular weight of 224.25 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide |
| PubChem CID | 82005349 |
| Molecular Formula | C9H18F2N2O2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide |
| SMILES | CN(CCCN)C(=O)CCOCC(F)F |
| InChI | InChI=1S/C9H18F2N2O2/c1-13(5-2-4-12)9(14)3-6-15-7-8(10)11/h8H,2-7,12H2,1H3 |
| InChIKey | ZKZCQAOEYBOHNR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide?
The IUPAC name of N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide (CID 82005349) is N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide.
What is the SMILES notation for N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide?
The canonical SMILES for N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide is CN(CCCN)C(=O)CCOCC(F)F.
What is the InChIKey of N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide?
The InChIKey is ZKZCQAOEYBOHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F2N2O2/c1-13(5-2-4-12)9(14)3-6-15-7-8(10)11/h8H,2-7,12H2,1H3.
What are the key properties of N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide?
N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide has a molecular weight of 224.25 g/mol, XLogP of 0.47, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-3-(2,2-difluoroethoxy)-N-methylpropanamide is sourced from PubChem (CID 82005349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).