About [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine
[5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 82005696) has the molecular formula C6H9F2N3OS
and a molecular weight of 209.22 g/mol. Its IUPAC name is [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine |
| PubChem CID | 82005696 |
| Molecular Formula | C6H9F2N3OS |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(COCC(F)F)s1 |
| InChI | InChI=1S/C6H9F2N3OS/c7-5(8)3-12-2-4-1-10-6(11-9)13-4/h1,5H,2-3,9H2,(H,10,11) |
| InChIKey | UZXJZKAGVNRLTP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine?
The IUPAC name of [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine (CID 82005696) is [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine.
What is the SMILES notation for [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine?
The canonical SMILES for [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine is NNc1ncc(COCC(F)F)s1.
What is the InChIKey of [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine?
The InChIKey is UZXJZKAGVNRLTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F2N3OS/c7-5(8)3-12-2-4-1-10-6(11-9)13-4/h1,5H,2-3,9H2,(H,10,11).
What are the key properties of [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine?
[5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine has a molecular weight of 209.22 g/mol, XLogP of 1.21, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,2-difluoroethoxymethyl)-1,3-thiazol-2-yl]hydrazine is sourced from PubChem (CID 82005696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).