About 2-(2,2-difluoroethoxy)acetic acid
2-(2,2-difluoroethoxy)acetic acid (PubChem CID 82005911) has the molecular formula C4H6F2O3
and a molecular weight of 140.08 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)acetic acid.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)acetic acid |
| PubChem CID | 82005911 |
| Molecular Formula | C4H6F2O3 |
| Molecular Weight | 140.08 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 2-(2,2-difluoroethoxy)acetic acid |
| SMILES | O=C(O)COCC(F)F |
| InChI | InChI=1S/C4H6F2O3/c5-3(6)1-9-2-4(7)8/h3H,1-2H2,(H,7,8) |
| InChIKey | GQTMDIOFKUTFDR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.08 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,2-difluoroethoxy)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)acetic acid?
The IUPAC name of 2-(2,2-difluoroethoxy)acetic acid (CID 82005911) is 2-(2,2-difluoroethoxy)acetic acid.
What is the SMILES notation for 2-(2,2-difluoroethoxy)acetic acid?
The canonical SMILES for 2-(2,2-difluoroethoxy)acetic acid is O=C(O)COCC(F)F.
What is the InChIKey of 2-(2,2-difluoroethoxy)acetic acid?
The InChIKey is GQTMDIOFKUTFDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2O3/c5-3(6)1-9-2-4(7)8/h3H,1-2H2,(H,7,8).
What are the key properties of 2-(2,2-difluoroethoxy)acetic acid?
2-(2,2-difluoroethoxy)acetic acid has a molecular weight of 140.08 g/mol, XLogP of 0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)acetic acid is sourced from PubChem (CID 82005911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).