About 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole
4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole (PubChem CID 82005930) has the molecular formula C8H10ClF2NOS
and a molecular weight of 241.69 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole |
| PubChem CID | 82005930 |
| Molecular Formula | C8H10ClF2NOS |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole |
| SMILES | CC(OCC(F)F)c1nc(CCl)cs1 |
| InChI | InChI=1S/C8H10ClF2NOS/c1-5(13-3-7(10)11)8-12-6(2-9)4-14-8/h4-5,7H,2-3H2,1H3 |
| InChIKey | SRIQNMQVKWJUNZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole?
The IUPAC name of 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole (CID 82005930) is 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole.
What is the SMILES notation for 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole?
The canonical SMILES for 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole is CC(OCC(F)F)c1nc(CCl)cs1.
What is the InChIKey of 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole?
The InChIKey is SRIQNMQVKWJUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClF2NOS/c1-5(13-3-7(10)11)8-12-6(2-9)4-14-8/h4-5,7H,2-3H2,1H3.
What are the key properties of 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole?
4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole has a molecular weight of 241.69 g/mol, XLogP of 3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2-[1-(2,2-difluoroethoxy)ethyl]-1,3-thiazole is sourced from PubChem (CID 82005930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).