About [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol
[6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol (PubChem CID 82006204) has the molecular formula C7H8F2N2O2
and a molecular weight of 190.15 g/mol. Its IUPAC name is [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol.
Molecular Properties
| Compound Name | [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol |
| PubChem CID | 82006204 |
| Molecular Formula | C7H8F2N2O2 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol |
| SMILES | OCc1cncc(OCC(F)F)n1 |
| InChI | InChI=1S/C7H8F2N2O2/c8-6(9)4-13-7-2-10-1-5(3-12)11-7/h1-2,6,12H,3-4H2 |
| InChIKey | UDKAPHBGEKPLIR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol?
The IUPAC name of [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol (CID 82006204) is [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol.
What is the SMILES notation for [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol?
The canonical SMILES for [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol is OCc1cncc(OCC(F)F)n1.
What is the InChIKey of [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol?
The InChIKey is UDKAPHBGEKPLIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O2/c8-6(9)4-13-7-2-10-1-5(3-12)11-7/h1-2,6,12H,3-4H2.
What are the key properties of [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol?
[6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol has a molecular weight of 190.15 g/mol, XLogP of 0.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,2-difluoroethoxy)pyrazin-2-yl]methanol is sourced from PubChem (CID 82006204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).