C10H11BrF2O2 — CID 82006553
2-bromo-4-(2,2-difluoroethoxymethyl)-1-methoxybenzene (PubChem CID 82006553) has the molecular formula C10H11BrF2O2 and a molecular weight of 281.10 g/mol. Its IUPAC name is 2-bromo-4-(2,2-difluoroethoxymethyl)-1-methoxybenzene.
| Compound Name | 2-bromo-4-(2,2-difluoroethoxymethyl)-1-methoxybenzene |
|---|---|
| PubChem CID | 82006553 |
| Molecular Formula | C10H11BrF2O2 |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-bromo-4-(2,2-difluoroethoxymethyl)-1-methoxybenzene |
| SMILES | COc1ccc(COCC(F)F)cc1Br |
| InChI | InChI=1S/C10H11BrF2O2/c1-14-9-3-2-7(4-8(9)11)5-15-6-10(12)13/h2-4,10H,5-6H2,1H3 |
| InChIKey | JBMQKUDRPPJZMG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |