C11H18F2N2O — CID 82006574
2-[2-(2,2-difluoroethoxy)ethyl]-1-(methylamino)cyclopentane-1-carbonitrile (PubChem CID 82006574) has the molecular formula C11H18F2N2O and a molecular weight of 232.27 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-1-(methylamino)cyclopentane-1-carbonitrile.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1-(methylamino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 82006574 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-1-(methylamino)cyclopentane-1-carbonitrile |
| SMILES | CNC1(C#N)CCCC1CCOCC(F)F |
| InChI | InChI=1S/C11H18F2N2O/c1-15-11(8-14)5-2-3-9(11)4-6-16-7-10(12)13/h9-10,15H,2-7H2,1H3 |
| InChIKey | CGCPFYZGUWSPSE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|