About N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine
N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine (PubChem CID 82006731) has the molecular formula C11H21F2NO
and a molecular weight of 221.29 g/mol. Its IUPAC name is N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine |
| PubChem CID | 82006731 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine |
| SMILES | CCCNCC1(OCC(F)F)CCCC1 |
| InChI | InChI=1S/C11H21F2NO/c1-2-7-14-9-11(5-3-4-6-11)15-8-10(12)13/h10,14H,2-9H2,1H3 |
| InChIKey | BCMMVEVGLFVVDM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine?
The IUPAC name of N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine (CID 82006731) is N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine.
What is the SMILES notation for N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine?
The canonical SMILES for N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine is CCCNCC1(OCC(F)F)CCCC1.
What is the InChIKey of N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine?
The InChIKey is BCMMVEVGLFVVDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2NO/c1-2-7-14-9-11(5-3-4-6-11)15-8-10(12)13/h10,14H,2-9H2,1H3.
What are the key properties of N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine?
N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine has a molecular weight of 221.29 g/mol, XLogP of 2.58, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(2,2-difluoroethoxy)cyclopentyl]methyl]propan-1-amine is sourced from PubChem (CID 82006731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).