C8H13F2N3O2S — CID 82006746
N-[[5-(2,2-difluoroethoxy)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 82006746) has the molecular formula C8H13F2N3O2S and a molecular weight of 253.27 g/mol. Its IUPAC name is N-[[5-(2,2-difluoroethoxy)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-(2,2-difluoroethoxy)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 82006746 |
| Molecular Formula | C8H13F2N3O2S |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[[5-(2,2-difluoroethoxy)-1,3,4-thiadiazol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nnc(OCC(F)F)s1 |
| InChI | InChI=1S/C8H13F2N3O2S/c1-14-3-2-11-4-7-12-13-8(16-7)15-5-6(9)10/h6,11H,2-5H2,1H3 |
| InChIKey | RPHXFVRXHXXGDQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|