About 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide
1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide (PubChem CID 82006834) has the molecular formula C8H14F2N2O2
and a molecular weight of 208.21 g/mol. Its IUPAC name is 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide |
| PubChem CID | 82006834 |
| Molecular Formula | C8H14F2N2O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(N)CCC(OCC(F)F)C1 |
| InChI | InChI=1S/C8H14F2N2O2/c9-6(10)4-14-5-1-2-8(12,3-5)7(11)13/h5-6H,1-4,12H2,(H2,11,13) |
| InChIKey | SVXBQWKPLHHJDN-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide?
The IUPAC name of 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide (CID 82006834) is 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide.
What is the SMILES notation for 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide?
The canonical SMILES for 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide is NC(=O)C1(N)CCC(OCC(F)F)C1.
What is the InChIKey of 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide?
The InChIKey is SVXBQWKPLHHJDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O2/c9-6(10)4-14-5-1-2-8(12,3-5)7(11)13/h5-6H,1-4,12H2,(H2,11,13).
What are the key properties of 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide?
1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide has a molecular weight of 208.21 g/mol, XLogP of 0.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(2,2-difluoroethoxy)cyclopentane-1-carboxamide is sourced from PubChem (CID 82006834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).