C8H13F2N3OS — CID 82006999
N-[[5-(2,2-difluoroethoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine (PubChem CID 82006999) has the molecular formula C8H13F2N3OS and a molecular weight of 237.27 g/mol. Its IUPAC name is N-[[5-(2,2-difluoroethoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2,2-difluoroethoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82006999 |
| Molecular Formula | C8H13F2N3OS |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-[[5-(2,2-difluoroethoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nnc(OCC(F)F)s1 |
| InChI | InChI=1S/C8H13F2N3OS/c1-2-3-11-4-7-12-13-8(15-7)14-5-6(9)10/h6,11H,2-5H2,1H3 |
| InChIKey | DAUDGKHYIBKHHN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|