C13H18N2O3S — CID 82007507
2-methoxy-6-methylsulfonyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline (PubChem CID 82007507) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 2-methoxy-6-methylsulfonyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline.
| Compound Name | 2-methoxy-6-methylsulfonyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 82007507 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-methoxy-6-methylsulfonyl-1,2,3,3a,4,5-hexahydropyrrolo[1,2-a]quinoxaline |
| SMILES | COC1CC2CNc3c(cccc3S(C)(=O)=O)N2C1 |
| InChI | InChI=1S/C13H18N2O3S/c1-18-10-6-9-7-14-13-11(15(9)8-10)4-3-5-12(13)19(2,16)17/h3-5,9-10,14H,6-8H2,1-2H3 |
| InChIKey | XGDANQGOWLWYPI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |