C12H17N3O2S — CID 82007591
7-methylsulfonyl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline (PubChem CID 82007591) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 7-methylsulfonyl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline.
| Compound Name | 7-methylsulfonyl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 82007591 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 7-methylsulfonyl-2,3,4,4a,5,6-hexahydro-1H-pyrazino[1,2-a]quinoxaline |
| SMILES | CS(=O)(=O)c1cccc2c1NCC1CNCCN21 |
| InChI | InChI=1S/C12H17N3O2S/c1-18(16,17)11-4-2-3-10-12(11)14-8-9-7-13-5-6-15(9)10/h2-4,9,13-14H,5-8H2,1H3 |
| InChIKey | YWFRFHTXJUNBBA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |