About 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline
3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline (PubChem CID 82007831) has the molecular formula C11H16N2O2S
and a molecular weight of 240.33 g/mol. Its IUPAC name is 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline |
| PubChem CID | 82007831 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline |
| SMILES | CC1(C)CNc2c(cccc2S(C)(=O)=O)N1 |
| InChI | InChI=1S/C11H16N2O2S/c1-11(2)7-12-10-8(13-11)5-4-6-9(10)16(3,14)15/h4-6,12-13H,7H2,1-3H3 |
| InChIKey | IETUEQUWAGNDBE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline?
The IUPAC name of 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline (CID 82007831) is 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline.
What is the SMILES notation for 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline?
The canonical SMILES for 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline is CC1(C)CNc2c(cccc2S(C)(=O)=O)N1.
What is the InChIKey of 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline?
The InChIKey is IETUEQUWAGNDBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-11(2)7-12-10-8(13-11)5-4-6-9(10)16(3,14)15/h4-6,12-13H,7H2,1-3H3.
What are the key properties of 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline?
3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline has a molecular weight of 240.33 g/mol, XLogP of 1.71, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-8-methylsulfonyl-2,4-dihydro-1H-quinoxaline is sourced from PubChem (CID 82007831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).