About 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine
2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine (PubChem CID 82007963) has the molecular formula C8H10F3N3O
and a molecular weight of 221.18 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine.
Molecular Properties
| Compound Name | 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine |
| PubChem CID | 82007963 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine |
| SMILES | NC1CCCC1c1nc(C(F)(F)F)no1 |
| InChI | InChI=1S/C8H10F3N3O/c9-8(10,11)7-13-6(15-14-7)4-2-1-3-5(4)12/h4-5H,1-3,12H2 |
| InChIKey | UYCVZQSMBVPDOF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine?
The IUPAC name of 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine (CID 82007963) is 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine.
What is the SMILES notation for 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine?
The canonical SMILES for 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine is NC1CCCC1c1nc(C(F)(F)F)no1.
What is the InChIKey of 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine?
The InChIKey is UYCVZQSMBVPDOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O/c9-8(10,11)7-13-6(15-14-7)4-2-1-3-5(4)12/h4-5H,1-3,12H2.
What are the key properties of 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine?
2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine has a molecular weight of 221.18 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]cyclopentan-1-amine is sourced from PubChem (CID 82007963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).