About 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine
1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine (PubChem CID 82008553) has the molecular formula C8H12F3N3O
and a molecular weight of 223.20 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine.
Molecular Properties
| Compound Name | 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
| PubChem CID | 82008553 |
| Molecular Formula | C8H12F3N3O |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
| SMILES | CCCCC(N)c1nc(C(F)(F)F)no1 |
| InChI | InChI=1S/C8H12F3N3O/c1-2-3-4-5(12)6-13-7(14-15-6)8(9,10)11/h5H,2-4,12H2,1H3 |
| InChIKey | IMRSIXHDNDHTCB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine?
The IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine (CID 82008553) is 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine.
What is the SMILES notation for 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine?
The canonical SMILES for 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine is CCCCC(N)c1nc(C(F)(F)F)no1.
What is the InChIKey of 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine?
The InChIKey is IMRSIXHDNDHTCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3N3O/c1-2-3-4-5(12)6-13-7(14-15-6)8(9,10)11/h5H,2-4,12H2,1H3.
What are the key properties of 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine?
1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine has a molecular weight of 223.20 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(trifluoromethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine is sourced from PubChem (CID 82008553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).