C13H17N3O2S — CID 82008605
4-methylsulfonyl-2-(pyrrolidin-3-ylmethyl)-1H-benzimidazole (PubChem CID 82008605) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-methylsulfonyl-2-(pyrrolidin-3-ylmethyl)-1H-benzimidazole.
| Compound Name | 4-methylsulfonyl-2-(pyrrolidin-3-ylmethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 82008605 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-methylsulfonyl-2-(pyrrolidin-3-ylmethyl)-1H-benzimidazole |
| SMILES | CS(=O)(=O)c1cccc2[nH]c(CC3CCNC3)nc12 |
| InChI | InChI=1S/C13H17N3O2S/c1-19(17,18)11-4-2-3-10-13(11)16-12(15-10)7-9-5-6-14-8-9/h2-4,9,14H,5-8H2,1H3,(H,15,16) |
| InChIKey | PPEPFKSCKGOWBW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |