About 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide
3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide (PubChem CID 82008850) has the molecular formula C7H15F2NO3S
and a molecular weight of 231.26 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide |
| PubChem CID | 82008850 |
| Molecular Formula | C7H15F2NO3S |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(COCC(F)F)CS(N)(=O)=O |
| InChI | InChI=1S/C7H15F2NO3S/c1-7(2,5-14(10,11)12)4-13-3-6(8)9/h6H,3-5H2,1-2H3,(H2,10,11,12) |
| InChIKey | BHGRVQYLNLSIEJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide?
The IUPAC name of 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide (CID 82008850) is 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide.
What is the SMILES notation for 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide?
The canonical SMILES for 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide is CC(C)(COCC(F)F)CS(N)(=O)=O.
What is the InChIKey of 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide?
The InChIKey is BHGRVQYLNLSIEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F2NO3S/c1-7(2,5-14(10,11)12)4-13-3-6(8)9/h6H,3-5H2,1-2H3,(H2,10,11,12).
What are the key properties of 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide?
3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide has a molecular weight of 231.26 g/mol, XLogP of 0.58, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethoxy)-2,2-dimethylpropane-1-sulfonamide is sourced from PubChem (CID 82008850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).