C9H12F2N4O3 — CID 82008983
6-(2,2-difluoroethoxy)-5-nitro-N-propylpyrimidin-4-amine (PubChem CID 82008983) has the molecular formula C9H12F2N4O3 and a molecular weight of 262.22 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)-5-nitro-N-propylpyrimidin-4-amine.
| Compound Name | 6-(2,2-difluoroethoxy)-5-nitro-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 82008983 |
| Molecular Formula | C9H12F2N4O3 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 6-(2,2-difluoroethoxy)-5-nitro-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(OCC(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12F2N4O3/c1-2-3-12-8-7(15(16)17)9(14-5-13-8)18-4-6(10)11/h5-6H,2-4H2,1H3,(H,12,13,14) |
| InChIKey | MGCAQVFOJBEEIJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|