About [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine
[2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 82009001) has the molecular formula C10H14F2N4O
and a molecular weight of 244.24 g/mol. Its IUPAC name is [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine |
| PubChem CID | 82009001 |
| Molecular Formula | C10H14F2N4O |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1c(NN)nc(C2CC2)nc1OCC(F)F |
| InChI | InChI=1S/C10H14F2N4O/c1-5-8(16-13)14-9(6-2-3-6)15-10(5)17-4-7(11)12/h6-7H,2-4,13H2,1H3,(H,14,15,16) |
| InChIKey | QUXQVTCSFTUIHZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine?
The IUPAC name of [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine (CID 82009001) is [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine is Cc1c(NN)nc(C2CC2)nc1OCC(F)F.
What is the InChIKey of [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine?
The InChIKey is QUXQVTCSFTUIHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N4O/c1-5-8(16-13)14-9(6-2-3-6)15-10(5)17-4-7(11)12/h6-7H,2-4,13H2,1H3,(H,14,15,16).
What are the key properties of [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine?
[2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine has a molecular weight of 244.24 g/mol, XLogP of 1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyclopropyl-6-(2,2-difluoroethoxy)-5-methylpyrimidin-4-yl]hydrazine is sourced from PubChem (CID 82009001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).