About 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane
2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane (PubChem CID 82009086) has the molecular formula C8H13BrF2O
and a molecular weight of 243.09 g/mol. Its IUPAC name is 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane.
Molecular Properties
| Compound Name | 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane |
| PubChem CID | 82009086 |
| Molecular Formula | C8H13BrF2O |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane |
| SMILES | CC1(C)C(Br)CC1OCC(F)F |
| InChI | InChI=1S/C8H13BrF2O/c1-8(2)5(9)3-6(8)12-4-7(10)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | KHKLJIASWPPANC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane?
The IUPAC name of 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane (CID 82009086) is 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane.
What is the SMILES notation for 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane?
The canonical SMILES for 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane is CC1(C)C(Br)CC1OCC(F)F.
What is the InChIKey of 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane?
The InChIKey is KHKLJIASWPPANC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrF2O/c1-8(2)5(9)3-6(8)12-4-7(10)11/h5-7H,3-4H2,1-2H3.
What are the key properties of 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane?
2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane has a molecular weight of 243.09 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(2,2-difluoroethoxy)-1,1-dimethylcyclobutane is sourced from PubChem (CID 82009086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).