About 4-(2,2-difluoroethoxy)pyrimidin-2-amine
4-(2,2-difluoroethoxy)pyrimidin-2-amine (PubChem CID 82009217) has the molecular formula C6H7F2N3O
and a molecular weight of 175.14 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethoxy)pyrimidin-2-amine |
| PubChem CID | 82009217 |
| Molecular Formula | C6H7F2N3O |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 4-(2,2-difluoroethoxy)pyrimidin-2-amine |
| SMILES | Nc1nccc(OCC(F)F)n1 |
| InChI | InChI=1S/C6H7F2N3O/c7-4(8)3-12-5-1-2-10-6(9)11-5/h1-2,4H,3H2,(H2,9,10,11) |
| InChIKey | SAVUWOAMEFTZOD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,2-difluoroethoxy)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethoxy)pyrimidin-2-amine?
The IUPAC name of 4-(2,2-difluoroethoxy)pyrimidin-2-amine (CID 82009217) is 4-(2,2-difluoroethoxy)pyrimidin-2-amine.
What is the SMILES notation for 4-(2,2-difluoroethoxy)pyrimidin-2-amine?
The canonical SMILES for 4-(2,2-difluoroethoxy)pyrimidin-2-amine is Nc1nccc(OCC(F)F)n1.
What is the InChIKey of 4-(2,2-difluoroethoxy)pyrimidin-2-amine?
The InChIKey is SAVUWOAMEFTZOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F2N3O/c7-4(8)3-12-5-1-2-10-6(9)11-5/h1-2,4H,3H2,(H2,9,10,11).
What are the key properties of 4-(2,2-difluoroethoxy)pyrimidin-2-amine?
4-(2,2-difluoroethoxy)pyrimidin-2-amine has a molecular weight of 175.14 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethoxy)pyrimidin-2-amine is sourced from PubChem (CID 82009217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).