About adamantane-1,3,5,7-tetrol
adamantane-1,3,5,7-tetrol (PubChem CID 820093) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is adamantane-1,3,5,7-tetrol.
Molecular Properties
| Compound Name | adamantane-1,3,5,7-tetrol |
| PubChem CID | 820093 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | adamantane-1,3,5,7-tetrol |
| SMILES | OC12CC3(O)CC(O)(C1)CC(O)(C2)C3 |
| InChI | InChI=1S/C10H16O4/c11-7-1-8(12)4-9(13,2-7)6-10(14,3-7)5-8/h11-14H,1-6H2 |
| InChIKey | CPWNSSYGNSROKX-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze adamantane-1,3,5,7-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-1,3,5,7-tetrol?
The IUPAC name of adamantane-1,3,5,7-tetrol (CID 820093) is adamantane-1,3,5,7-tetrol.
What is the SMILES notation for adamantane-1,3,5,7-tetrol?
The canonical SMILES for adamantane-1,3,5,7-tetrol is OC12CC3(O)CC(O)(C1)CC(O)(C2)C3.
What is the InChIKey of adamantane-1,3,5,7-tetrol?
The InChIKey is CPWNSSYGNSROKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c11-7-1-8(12)4-9(13,2-7)6-10(14,3-7)5-8/h11-14H,1-6H2.
What are the key properties of adamantane-1,3,5,7-tetrol?
adamantane-1,3,5,7-tetrol has a molecular weight of 200.23 g/mol, XLogP of -0.71, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-1,3,5,7-tetrol is sourced from PubChem (CID 820093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).