C14H17ClN2O — CID 82009732
6-[chloro(cyclobutyl)methyl]-3-methyl-1,4-dihydroquinazolin-2-one (PubChem CID 82009732) has the molecular formula C14H17ClN2O and a molecular weight of 264.76 g/mol. Its IUPAC name is 6-[chloro(cyclobutyl)methyl]-3-methyl-1,4-dihydroquinazolin-2-one.
| Compound Name | 6-[chloro(cyclobutyl)methyl]-3-methyl-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 82009732 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 6-[chloro(cyclobutyl)methyl]-3-methyl-1,4-dihydroquinazolin-2-one |
| SMILES | CN1Cc2cc(C(Cl)C3CCC3)ccc2NC1=O |
| InChI | InChI=1S/C14H17ClN2O/c1-17-8-11-7-10(13(15)9-3-2-4-9)5-6-12(11)16-14(17)18/h5-7,9,13H,2-4,8H2,1H3,(H,16,18) |
| InChIKey | STOFSQAXOVULPN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|