C12H12F4N2O2 — CID 82009846
3-methyl-6-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-1,4-dihydroquinazolin-2-one (PubChem CID 82009846) has the molecular formula C12H12F4N2O2 and a molecular weight of 292.23 g/mol. Its IUPAC name is 3-methyl-6-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-1,4-dihydroquinazolin-2-one.
| Compound Name | 3-methyl-6-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 82009846 |
| Molecular Formula | C12H12F4N2O2 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-methyl-6-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-1,4-dihydroquinazolin-2-one |
| SMILES | CN1Cc2cc(C(O)C(F)(F)C(F)F)ccc2NC1=O |
| InChI | InChI=1S/C12H12F4N2O2/c1-18-5-7-4-6(2-3-8(7)17-11(18)20)9(19)12(15,16)10(13)14/h2-4,9-10,19H,5H2,1H3,(H,17,20) |
| InChIKey | MAAJPZOAIKHIBS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|