C14H18N2O2 — CID 82010256
3-methyl-6-(2-methylbutanoyl)-1,4-dihydroquinazolin-2-one (PubChem CID 82010256) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-methyl-6-(2-methylbutanoyl)-1,4-dihydroquinazolin-2-one.
| Compound Name | 3-methyl-6-(2-methylbutanoyl)-1,4-dihydroquinazolin-2-one |
|---|---|
| PubChem CID | 82010256 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-methyl-6-(2-methylbutanoyl)-1,4-dihydroquinazolin-2-one |
| SMILES | CCC(C)C(=O)c1ccc2c(c1)CN(C)C(=O)N2 |
| InChI | InChI=1S/C14H18N2O2/c1-4-9(2)13(17)10-5-6-12-11(7-10)8-16(3)14(18)15-12/h5-7,9H,4,8H2,1-3H3,(H,15,18) |
| InChIKey | JOKPSYFKTAEGNK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |