About 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine
6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine (PubChem CID 82010531) has the molecular formula C10H15F2N3O
and a molecular weight of 231.25 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine |
| PubChem CID | 82010531 |
| Molecular Formula | C10H15F2N3O |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(OCC(F)F)c1C |
| InChI | InChI=1S/C10H15F2N3O/c1-3-4-13-9-7(2)10(15-6-14-9)16-5-8(11)12/h6,8H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | DUGLEDZTEVYOGJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine?
The IUPAC name of 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine (CID 82010531) is 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine.
What is the SMILES notation for 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine?
The canonical SMILES for 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine is CCCNc1ncnc(OCC(F)F)c1C.
What is the InChIKey of 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine?
The InChIKey is DUGLEDZTEVYOGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2N3O/c1-3-4-13-9-7(2)10(15-6-14-9)16-5-8(11)12/h6,8H,3-5H2,1-2H3,(H,13,14,15).
What are the key properties of 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine?
6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine has a molecular weight of 231.25 g/mol, XLogP of 2.25, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoroethoxy)-5-methyl-N-propylpyrimidin-4-amine is sourced from PubChem (CID 82010531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).