C15H19F3INS — CID 82011036
2-iodo-N-[2-(trifluoromethyl)cyclohexyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82011036) has the molecular formula C15H19F3INS and a molecular weight of 429.29 g/mol. Its IUPAC name is 2-iodo-N-[2-(trifluoromethyl)cyclohexyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-iodo-N-[2-(trifluoromethyl)cyclohexyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82011036 |
| Molecular Formula | C15H19F3INS |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 2-iodo-N-[2-(trifluoromethyl)cyclohexyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | FC(F)(F)C1CCCCC1NC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C15H19F3INS/c16-15(17,18)10-4-1-2-5-12(10)20-11-6-3-7-13-9(11)8-14(19)21-13/h8,10-12,20H,1-7H2 |
| InChIKey | BJTSIRASFWTDMD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|