C14H23BrN2O2S2 — CID 82012032
N-[3-[(2-bromo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propyl]-N-ethylmethanesulfonamide (PubChem CID 82012032) has the molecular formula C14H23BrN2O2S2 and a molecular weight of 395.39 g/mol. Its IUPAC name is N-[3-[(2-bromo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[3-[(2-bromo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 82012032 |
| Molecular Formula | C14H23BrN2O2S2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | N-[3-[(2-bromo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNC1CCCc2sc(Br)cc21)S(C)(=O)=O |
| InChI | InChI=1S/C14H23BrN2O2S2/c1-3-17(21(2,18)19)9-5-8-16-12-6-4-7-13-11(12)10-14(15)20-13/h10,12,16H,3-9H2,1-2H3 |
| InChIKey | AHBWXTXBDQZBOU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|