C17H19FINS — CID 82012276
N-[1-(4-fluorophenyl)propan-2-yl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82012276) has the molecular formula C17H19FINS and a molecular weight of 415.32 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)propan-2-yl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-[1-(4-fluorophenyl)propan-2-yl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82012276 |
| Molecular Formula | C17H19FINS |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-[1-(4-fluorophenyl)propan-2-yl]-2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CC(Cc1ccc(F)cc1)NC1CCCc2sc(I)cc21 |
| InChI | InChI=1S/C17H19FINS/c1-11(9-12-5-7-13(18)8-6-12)20-15-3-2-4-16-14(15)10-17(19)21-16/h5-8,10-11,15,20H,2-4,9H2,1H3 |
| InChIKey | ZFVMLNKPYZZJKF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|