C12H22N4O4S — CID 82012417
2-[1-(3-amino-1-ethylpyrazol-4-yl)sulfonylpiperidin-4-yl]oxyethanol (PubChem CID 82012417) has the molecular formula C12H22N4O4S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-[1-(3-amino-1-ethylpyrazol-4-yl)sulfonylpiperidin-4-yl]oxyethanol.
| Compound Name | 2-[1-(3-amino-1-ethylpyrazol-4-yl)sulfonylpiperidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 82012417 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-[1-(3-amino-1-ethylpyrazol-4-yl)sulfonylpiperidin-4-yl]oxyethanol |
| SMILES | CCn1cc(S(=O)(=O)N2CCC(OCCO)CC2)c(N)n1 |
| InChI | InChI=1S/C12H22N4O4S/c1-2-15-9-11(12(13)14-15)21(18,19)16-5-3-10(4-6-16)20-8-7-17/h9-10,17H,2-8H2,1H3,(H2,13,14) |
| InChIKey | RVRCVGVFFSCCLK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |