About 2-amino-3,6-diethylbenzonitrile;hydrochloride
2-amino-3,6-diethylbenzonitrile;hydrochloride (PubChem CID 82013541) has the molecular formula C11H15ClN2
and a molecular weight of 210.71 g/mol. Its IUPAC name is 2-amino-3,6-diethylbenzonitrile;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-3,6-diethylbenzonitrile;hydrochloride |
| PubChem CID | 82013541 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-amino-3,6-diethylbenzonitrile;hydrochloride |
| SMILES | CCc1ccc(CC)c(C#N)c1N.Cl |
| InChI | InChI=1S/C11H14N2.ClH/c1-3-8-5-6-9(4-2)11(13)10(8)7-12;/h5-6H,3-4,13H2,1-2H3;1H |
| InChIKey | IURACDCRYPHCMK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,6-diethylbenzonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,6-diethylbenzonitrile;hydrochloride?
The IUPAC name of 2-amino-3,6-diethylbenzonitrile;hydrochloride (CID 82013541) is 2-amino-3,6-diethylbenzonitrile;hydrochloride.
What is the SMILES notation for 2-amino-3,6-diethylbenzonitrile;hydrochloride?
The canonical SMILES for 2-amino-3,6-diethylbenzonitrile;hydrochloride is CCc1ccc(CC)c(C#N)c1N.Cl.
What is the InChIKey of 2-amino-3,6-diethylbenzonitrile;hydrochloride?
The InChIKey is IURACDCRYPHCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2.ClH/c1-3-8-5-6-9(4-2)11(13)10(8)7-12;/h5-6H,3-4,13H2,1-2H3;1H.
What are the key properties of 2-amino-3,6-diethylbenzonitrile;hydrochloride?
2-amino-3,6-diethylbenzonitrile;hydrochloride has a molecular weight of 210.71 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,6-diethylbenzonitrile;hydrochloride is sourced from PubChem (CID 82013541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).