C12H21N3O6 — CID 82015600
4-amino-2-[[4-(2-hydroxyethoxy)piperidine-1-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 82015600) has the molecular formula C12H21N3O6 and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-amino-2-[[4-(2-hydroxyethoxy)piperidine-1-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[4-(2-hydroxyethoxy)piperidine-1-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82015600 |
| Molecular Formula | C12H21N3O6 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 4-amino-2-[[4-(2-hydroxyethoxy)piperidine-1-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)N1CCC(OCCO)CC1)C(=O)O |
| InChI | InChI=1S/C12H21N3O6/c13-10(17)7-9(11(18)19)14-12(20)15-3-1-8(2-4-15)21-6-5-16/h8-9,16H,1-7H2,(H2,13,17)(H,14,20)(H,18,19) |
| InChIKey | YMZNOOCGWSCXHG-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |