C14H9FN4S — CID 82015748
5-fluoro-2-(7-methyl-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)benzonitrile (PubChem CID 82015748) has the molecular formula C14H9FN4S and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-fluoro-2-(7-methyl-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)benzonitrile.
| Compound Name | 5-fluoro-2-(7-methyl-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)benzonitrile |
|---|---|
| PubChem CID | 82015748 |
| Molecular Formula | C14H9FN4S |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-fluoro-2-(7-methyl-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)benzonitrile |
| SMILES | Cc1ccnc2c1[nH]c(=S)n2-c1ccc(F)cc1C#N |
| InChI | InChI=1S/C14H9FN4S/c1-8-4-5-17-13-12(8)18-14(20)19(13)11-3-2-10(15)6-9(11)7-16/h2-6H,1H3,(H,18,20) |
| InChIKey | MYFXMJQOADBNNZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|