C13H16FN3O — CID 82015813
4-amino-N-(2-cyano-4-fluorophenyl)-4-methylpentanamide (PubChem CID 82015813) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is 4-amino-N-(2-cyano-4-fluorophenyl)-4-methylpentanamide.
| Compound Name | 4-amino-N-(2-cyano-4-fluorophenyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 82015813 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 4-amino-N-(2-cyano-4-fluorophenyl)-4-methylpentanamide |
| SMILES | CC(C)(N)CCC(=O)Nc1ccc(F)cc1C#N |
| InChI | InChI=1S/C13H16FN3O/c1-13(2,16)6-5-12(18)17-11-4-3-10(14)7-9(11)8-15/h3-4,7H,5-6,16H2,1-2H3,(H,17,18) |
| InChIKey | QRUNOGOSOBMKOE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |